C28H38N8O2 — CID 46850266
2-N-benzyl-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 46850266) has the molecular formula C28H38N8O2 and a molecular weight of 518.67 g/mol. Its IUPAC name is 2-N-benzyl-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46850266 |
| Molecular Formula | C28H38N8O2 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 2-N-benzyl-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc2c(cc1OC)CN(c1nc(NCCN3CCN(C)CC3)nc(NCc3ccccc3)n1)CC2 |
| InChI | InChI=1S/C28H38N8O2/c1-34-13-15-35(16-14-34)12-10-29-26-31-27(30-19-21-7-5-4-6-8-21)33-28(32-26)36-11-9-22-17-24(37-2)25(38-3)18-23(22)20-36/h4-8,17-18H,9-16,19-20H2,1-3H3,(H2,29,30,31,32,33) |
| InChIKey | YWYWVKRYAFRKOY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |