C20H35N — CID 46850844
(3E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-3,8-dien-1-amine (PubChem CID 46850844) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (3E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-3,8-dien-1-amine.
| Compound Name | (3E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-3,8-dien-1-amine |
|---|---|
| PubChem CID | 46850844 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (3E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-3,8-dien-1-amine |
| SMILES | CC1=C(/C=C/C(C)CC/C=C(\C)CCN)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H35N/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h9,11-12,16H,6-8,10,13-15,21H2,1-5H3/b12-11+,17-9+ |
| InChIKey | GVEPCXKJTVEDJC-UPMJEZSJSA-N |
| XLogP | 5.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|