C33H30ClF3N6O5S2 — CID 46850940
2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid (PubChem CID 46850940) has the molecular formula C33H30ClF3N6O5S2 and a molecular weight of 747.22 g/mol. Its IUPAC name is 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46850940 |
| Molecular Formula | C33H30ClF3N6O5S2 |
| Molecular Weight | 747.22 g/mol |
| Exact Mass | 746.14 |
| IUPAC Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCNc1nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c(-c2ccc(OCCOC(=O)[C@H](C)N)cc2)c1C#N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H29ClN6O3S2.C2HF3O2/c1-3-12-36-28-25(15-33)27(20-6-10-24(11-7-20)40-13-14-41-31(39)19(2)35)26(16-34)30(38-28)43-18-23-17-42-29(37-23)21-4-8-22(32)9-5-21;3-2(4,5)1(6)7/h4-11,17,19H,3,12-14,18,35H2,1-2H3,(H,36,38);(H,6,7)/t19-;/m0./s1 |
| InChIKey | BDUFCBTYXVTMEW-FYZYNONXSA-N |
| XLogP | 7.29 |
| TPSA | 184.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.22 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|