About 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol
1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol (PubChem CID 46851045) has the molecular formula C21H17Br2N5O
and a molecular weight of 515.21 g/mol. Its IUPAC name is 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
| PubChem CID | 46851045 |
| Molecular Formula | C21H17Br2N5O |
| Molecular Weight | 515.21 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol |
| SMILES | [N-]=[N+]=Nc1cccc(NCC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C21H17Br2N5O/c22-13-4-6-20-18(8-13)19-9-14(23)5-7-21(19)28(20)12-17(29)11-25-15-2-1-3-16(10-15)26-27-24/h1-10,17,25,29H,11-12H2 |
| InChIKey | ZDQAYKRQOQQFCB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.21 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol?
The IUPAC name of 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol (CID 46851045) is 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol.
What is the SMILES notation for 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol?
The canonical SMILES for 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol is [N-]=[N+]=Nc1cccc(NCC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)c1.
What is the InChIKey of 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol?
The InChIKey is ZDQAYKRQOQQFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Br2N5O/c22-13-4-6-20-18(8-13)19-9-14(23)5-7-21(19)28(20)12-17(29)11-25-15-2-1-3-16(10-15)26-27-24/h1-10,17,25,29H,11-12H2.
What are the key properties of 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol?
1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol has a molecular weight of 515.21 g/mol, XLogP of 6.73, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azidoanilino)-3-(3,6-dibromocarbazol-9-yl)propan-2-ol is sourced from PubChem (CID 46851045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).