About 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid
9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid (PubChem CID 46851355) has the molecular formula C14H18N2O5
and a molecular weight of 294.31 g/mol. Its IUPAC name is 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid.
Molecular Properties
| Compound Name | 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid |
| PubChem CID | 46851355 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid |
| SMILES | CCC(=O)O.Cc1nc2c(O)cccn2c(=O)c1CCO |
| InChI | InChI=1S/C11H12N2O3.C3H6O2/c1-7-8(4-6-14)11(16)13-5-2-3-9(15)10(13)12-7;1-2-3(4)5/h2-3,5,14-15H,4,6H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | KKVVTNGWTJXXKR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid?
The IUPAC name of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid (CID 46851355) is 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid.
What is the SMILES notation for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid?
The canonical SMILES for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid is CCC(=O)O.Cc1nc2c(O)cccn2c(=O)c1CCO.
What is the InChIKey of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid?
The InChIKey is KKVVTNGWTJXXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3.C3H6O2/c1-7-8(4-6-14)11(16)13-5-2-3-9(15)10(13)12-7;1-2-3(4)5/h2-3,5,14-15H,4,6H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid?
9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid has a molecular weight of 294.31 g/mol, XLogP of 0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;propanoic acid is sourced from PubChem (CID 46851355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).