C23H35F3N4O2 — CID 46851476
N-[[(1R,3S)-3-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-2,2,3-trimethylcyclopentyl]methyl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 46851476) has the molecular formula C23H35F3N4O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[[(1R,3S)-3-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-2,2,3-trimethylcyclopentyl]methyl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[[(1R,3S)-3-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-2,2,3-trimethylcyclopentyl]methyl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 46851476 |
| Molecular Formula | C23H35F3N4O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | N-[[(1R,3S)-3-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-2,2,3-trimethylcyclopentyl]methyl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC1(C)[C@H](CNC(=O)C2CCC(F)(F)CC2)CC[C@]1(C)NCC(=O)N1C[C@@H](F)C[C@H]1C#N |
| InChI | InChI=1S/C23H35F3N4O2/c1-21(2)16(12-28-20(32)15-4-8-23(25,26)9-5-15)6-7-22(21,3)29-13-19(31)30-14-17(24)10-18(30)11-27/h15-18,29H,4-10,12-14H2,1-3H3,(H,28,32)/t16-,17-,18-,22-/m0/s1 |
| InChIKey | WDVOOFVDNFHLAO-ORGXJRBJSA-N |
| XLogP | 3.18 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |