C34H46N2O6S2 — CID 46851998
2,7-bis[(4-tert-butylazepan-1-yl)sulfonyl]anthracene-9,10-dione (PubChem CID 46851998) has the molecular formula C34H46N2O6S2 and a molecular weight of 642.88 g/mol. Its IUPAC name is 2,7-bis[(4-tert-butylazepan-1-yl)sulfonyl]anthracene-9,10-dione.
| Compound Name | 2,7-bis[(4-tert-butylazepan-1-yl)sulfonyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 46851998 |
| Molecular Formula | C34H46N2O6S2 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2,7-bis[(4-tert-butylazepan-1-yl)sulfonyl]anthracene-9,10-dione |
| SMILES | CC(C)(C)C1CCCN(S(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)N4CCCC(C(C)(C)C)CC4)ccc2C3=O)CC1 |
| InChI | InChI=1S/C34H46N2O6S2/c1-33(2,3)23-9-7-17-35(19-15-23)43(39,40)25-11-13-27-29(21-25)32(38)30-22-26(12-14-28(30)31(27)37)44(41,42)36-18-8-10-24(16-20-36)34(4,5)6/h11-14,21-24H,7-10,15-20H2,1-6H3 |
| InChIKey | HOFJNVGEDCWCDQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|