About 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide
3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide (PubChem CID 46852299) has the molecular formula C20H34N4O3
and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide |
| PubChem CID | 46852299 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide |
| SMILES | O=C(NCC1CCOCC1)N1CC(C(=O)N2CCCN(C3CCC3)CC2)C1 |
| InChI | InChI=1S/C20H34N4O3/c25-19(23-8-2-7-22(9-10-23)18-3-1-4-18)17-14-24(15-17)20(26)21-13-16-5-11-27-12-6-16/h16-18H,1-15H2,(H,21,26) |
| InChIKey | DBGRQMZAMZYTJY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide?
The IUPAC name of 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide (CID 46852299) is 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide.
What is the SMILES notation for 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide?
The canonical SMILES for 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide is O=C(NCC1CCOCC1)N1CC(C(=O)N2CCCN(C3CCC3)CC2)C1.
What is the InChIKey of 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide?
The InChIKey is DBGRQMZAMZYTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N4O3/c25-19(23-8-2-7-22(9-10-23)18-3-1-4-18)17-14-24(15-17)20(26)21-13-16-5-11-27-12-6-16/h16-18H,1-15H2,(H,21,26).
What are the key properties of 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide?
3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide has a molecular weight of 378.52 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyclobutyl-1,4-diazepane-1-carbonyl)-N-(oxan-4-ylmethyl)azetidine-1-carboxamide is sourced from PubChem (CID 46852299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).