About N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine
N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 46852558) has the molecular formula C24H20F3N3S
and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 46852558 |
| Molecular Formula | C24H20F3N3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | CC1(C)CN(c2ccccc2Nc2nc3cc(C(F)(F)F)ccc3s2)c2ccccc21 |
| InChI | InChI=1S/C24H20F3N3S/c1-23(2)14-30(19-9-5-3-7-16(19)23)20-10-6-4-8-17(20)28-22-29-18-13-15(24(25,26)27)11-12-21(18)31-22/h3-13H,14H2,1-2H3,(H,28,29) |
| InChIKey | JJUABIBQQWYVCZ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine?
The IUPAC name of N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine (CID 46852558) is N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine is CC1(C)CN(c2ccccc2Nc2nc3cc(C(F)(F)F)ccc3s2)c2ccccc21.
What is the InChIKey of N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine?
The InChIKey is JJUABIBQQWYVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F3N3S/c1-23(2)14-30(19-9-5-3-7-16(19)23)20-10-6-4-8-17(20)28-22-29-18-13-15(24(25,26)27)11-12-21(18)31-22/h3-13H,14H2,1-2H3,(H,28,29).
What are the key properties of N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine?
N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine has a molecular weight of 439.51 g/mol, XLogP of 7.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-dimethyl-2H-indol-1-yl)phenyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 46852558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).