C23H43NO3 — CID 46852953
(Z)-16-[butanoyl(propan-2-yl)amino]hexadec-11-enoic acid (PubChem CID 46852953) has the molecular formula C23H43NO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is (Z)-16-[butanoyl(propan-2-yl)amino]hexadec-11-enoic acid.
| Compound Name | (Z)-16-[butanoyl(propan-2-yl)amino]hexadec-11-enoic acid |
|---|---|
| PubChem CID | 46852953 |
| Molecular Formula | C23H43NO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | (Z)-16-[butanoyl(propan-2-yl)amino]hexadec-11-enoic acid |
| SMILES | CCCC(=O)N(CCCC/C=C\CCCCCCCCCC(=O)O)C(C)C |
| InChI | InChI=1S/C23H43NO3/c1-4-18-22(25)24(21(2)3)20-17-15-13-11-9-7-5-6-8-10-12-14-16-19-23(26)27/h9,11,21H,4-8,10,12-20H2,1-3H3,(H,26,27)/b11-9- |
| InChIKey | DQHYWJWZMBQIEX-LUAWRHEFSA-N |
| XLogP | 6.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|