C33H20F6N2O6 — CID 46853881
5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-(4-hydroxy-2-methylphenyl)isoindole-1,3-dione (PubChem CID 46853881) has the molecular formula C33H20F6N2O6 and a molecular weight of 654.52 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-(4-hydroxy-2-methylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-(4-hydroxy-2-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 46853881 |
| Molecular Formula | C33H20F6N2O6 |
| Molecular Weight | 654.52 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-(4-hydroxy-2-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cc(O)ccc1N1C(=O)c2ccc(C(c3ccc4c(c3)C(=O)N(c3ccc(O)cc3C)C4=O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C33H20F6N2O6/c1-15-11-19(42)5-9-25(15)40-27(44)21-7-3-17(13-23(21)29(40)46)31(32(34,35)36,33(37,38)39)18-4-8-22-24(14-18)30(47)41(28(22)45)26-10-6-20(43)12-16(26)2/h3-14,42-43H,1-2H3 |
| InChIKey | PLNHPWWBEVCZJG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|