C19H29FN2 — CID 46853897
10-fluoro-2-heptyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline (PubChem CID 46853897) has the molecular formula C19H29FN2 and a molecular weight of 304.45 g/mol. Its IUPAC name is 10-fluoro-2-heptyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline.
| Compound Name | 10-fluoro-2-heptyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 46853897 |
| Molecular Formula | C19H29FN2 |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 10-fluoro-2-heptyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
| SMILES | CCCCCCCN1CCN2CCc3ccc(F)cc3C2C1 |
| InChI | InChI=1S/C19H29FN2/c1-2-3-4-5-6-10-21-12-13-22-11-9-16-7-8-17(20)14-18(16)19(22)15-21/h7-8,14,19H,2-6,9-13,15H2,1H3 |
| InChIKey | TVSPVSWXPWEVDR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|