C14H26N6 — CID 46854064
6-piperidin-1-yl-2-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine (PubChem CID 46854064) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 6-piperidin-1-yl-2-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-piperidin-1-yl-2-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46854064 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 6-piperidin-1-yl-2-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NCCC)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H26N6/c1-3-8-15-12-17-13(16-9-4-2)19-14(18-12)20-10-6-5-7-11-20/h3-11H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | QQMFKZUHUIKWPQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |