About 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline
5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline (PubChem CID 46854090) has the molecular formula C12H7Cl2N3O4
and a molecular weight of 328.11 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline.
Molecular Properties
| Compound Name | 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline |
| PubChem CID | 46854090 |
| Molecular Formula | C12H7Cl2N3O4 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C12H7Cl2N3O4/c13-7-1-3-8(4-2-7)15-10-5-9(14)11(16(18)19)6-12(10)17(20)21/h1-6,15H |
| InChIKey | LNQVHENYILLAKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline?
The IUPAC name of 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline (CID 46854090) is 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline.
What is the SMILES notation for 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline?
The canonical SMILES for 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccc(Cl)cc2)cc1Cl.
What is the InChIKey of 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline?
The InChIKey is LNQVHENYILLAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2N3O4/c13-7-1-3-8(4-2-7)15-10-5-9(14)11(16(18)19)6-12(10)17(20)21/h1-6,15H.
What are the key properties of 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline?
5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline has a molecular weight of 328.11 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4-chlorophenyl)-2,4-dinitroaniline is sourced from PubChem (CID 46854090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).