About diethyl (2-iodocyclopenten-1-yl) phosphate
diethyl (2-iodocyclopenten-1-yl) phosphate (PubChem CID 46854114) has the molecular formula C9H16IO4P
and a molecular weight of 346.10 g/mol. Its IUPAC name is diethyl (2-iodocyclopenten-1-yl) phosphate.
Molecular Properties
| Compound Name | diethyl (2-iodocyclopenten-1-yl) phosphate |
| PubChem CID | 46854114 |
| Molecular Formula | C9H16IO4P |
| Molecular Weight | 346.10 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | diethyl (2-iodocyclopenten-1-yl) phosphate |
| SMILES | CCOP(=O)(OCC)OC1=C(I)CCC1 |
| InChI | InChI=1S/C9H16IO4P/c1-3-12-15(11,13-4-2)14-9-7-5-6-8(9)10/h3-7H2,1-2H3 |
| InChIKey | WQWKCLOAWPOQBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.10 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2-iodocyclopenten-1-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2-iodocyclopenten-1-yl) phosphate?
The IUPAC name of diethyl (2-iodocyclopenten-1-yl) phosphate (CID 46854114) is diethyl (2-iodocyclopenten-1-yl) phosphate.
What is the SMILES notation for diethyl (2-iodocyclopenten-1-yl) phosphate?
The canonical SMILES for diethyl (2-iodocyclopenten-1-yl) phosphate is CCOP(=O)(OCC)OC1=C(I)CCC1.
What is the InChIKey of diethyl (2-iodocyclopenten-1-yl) phosphate?
The InChIKey is WQWKCLOAWPOQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16IO4P/c1-3-12-15(11,13-4-2)14-9-7-5-6-8(9)10/h3-7H2,1-2H3.
What are the key properties of diethyl (2-iodocyclopenten-1-yl) phosphate?
diethyl (2-iodocyclopenten-1-yl) phosphate has a molecular weight of 346.10 g/mol, XLogP of 4.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2-iodocyclopenten-1-yl) phosphate is sourced from PubChem (CID 46854114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).