C22H30O4Si — CID 46854166
(2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolane-3,4-diol (PubChem CID 46854166) has the molecular formula C22H30O4Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 46854166 |
| Molecular Formula | C22H30O4Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H30O4Si/c1-16-20(23)21(24)19(26-16)15-25-27(22(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19-21,23-24H,15H2,1-4H3/t16-,19+,20-,21+/m0/s1 |
| InChIKey | WIBDCRQFRNJLJK-NASSWSRMSA-N |
| XLogP | 2.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|