C29H41NO5Si — CID 46854193
methyl (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate (PubChem CID 46854193) has the molecular formula C29H41NO5Si and a molecular weight of 511.74 g/mol. Its IUPAC name is methyl (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate.
| Compound Name | methyl (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 46854193 |
| Molecular Formula | C29H41NO5Si |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | methyl (E,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO5Si/c1-28(2,3)35-27(32)30-23(16-14-15-21-26(31)33-7)22-34-36(29(4,5)6,24-17-10-8-11-18-24)25-19-12-9-13-20-25/h8-13,15,17-21,23H,14,16,22H2,1-7H3,(H,30,32)/b21-15+/t23-/m0/s1 |
| InChIKey | QXHBOJILHBTSLQ-QFVBLGFASA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|