C18H23NO — CID 46854328
(1S,4S,5R,6S)-5-methyl-5-phenyl-6-(prop-2-enylamino)bicyclo[2.2.2]octan-2-one (PubChem CID 46854328) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is (1S,4S,5R,6S)-5-methyl-5-phenyl-6-(prop-2-enylamino)bicyclo[2.2.2]octan-2-one.
| Compound Name | (1S,4S,5R,6S)-5-methyl-5-phenyl-6-(prop-2-enylamino)bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 46854328 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (1S,4S,5R,6S)-5-methyl-5-phenyl-6-(prop-2-enylamino)bicyclo[2.2.2]octan-2-one |
| SMILES | C=CCN[C@H]1[C@@H]2CC[C@@H](CC2=O)[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-3-11-19-17-15-10-9-14(12-16(15)20)18(17,2)13-7-5-4-6-8-13/h3-8,14-15,17,19H,1,9-12H2,2H3/t14-,15+,17-,18-/m0/s1 |
| InChIKey | ZNFGCNQHOSAJGB-MVJTYMMSSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|