C24H20N4O3S — CID 46854491
4-methyl-N-[2-[(10-oxo-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-12-yl)amino]ethyl]benzenesulfonamide (PubChem CID 46854491) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-methyl-N-[2-[(10-oxo-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-12-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[(10-oxo-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-12-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46854491 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-methyl-N-[2-[(10-oxo-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaen-12-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC2=CC(=O)c3nc4ccccc4c4ccnc2c34)cc1 |
| InChI | InChI=1S/C24H20N4O3S/c1-15-6-8-16(9-7-15)32(30,31)27-13-12-25-20-14-21(29)24-22-18(10-11-26-23(20)22)17-4-2-3-5-19(17)28-24/h2-11,14,25,27H,12-13H2,1H3 |
| InChIKey | HBALHLONFUQOEK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|