C27H48O6Si2 — CID 46854670
methyl (Z,3S,4R,5S,9R)-4-hydroxy-3-phenylmethoxy-5-trimethylsilyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enoate (PubChem CID 46854670) has the molecular formula C27H48O6Si2 and a molecular weight of 524.85 g/mol. Its IUPAC name is methyl (Z,3S,4R,5S,9R)-4-hydroxy-3-phenylmethoxy-5-trimethylsilyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enoate.
| Compound Name | methyl (Z,3S,4R,5S,9R)-4-hydroxy-3-phenylmethoxy-5-trimethylsilyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enoate |
|---|---|
| PubChem CID | 46854670 |
| Molecular Formula | C27H48O6Si2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | methyl (Z,3S,4R,5S,9R)-4-hydroxy-3-phenylmethoxy-5-trimethylsilyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enoate |
| SMILES | COC(=O)C[C@H](OCc1ccccc1)[C@@H](O)[C@H](/C=C\C[C@@H](C)OCOCC[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C27H48O6Si2/c1-22(33-21-31-17-18-34(3,4)5)13-12-16-25(35(6,7)8)27(29)24(19-26(28)30-2)32-20-23-14-10-9-11-15-23/h9-12,14-16,22,24-25,27,29H,13,17-21H2,1-8H3/b16-12-/t22-,24+,25+,27-/m1/s1 |
| InChIKey | VFJDQTUUMSMYJU-AGAUVLTRSA-N |
| XLogP | 5.87 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|