C24H40O7Si — CID 46854671
methyl (E,3S,4S,7S,9R)-4,7-dihydroxy-3-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)dec-5-enoate (PubChem CID 46854671) has the molecular formula C24H40O7Si and a molecular weight of 468.66 g/mol. Its IUPAC name is methyl (E,3S,4S,7S,9R)-4,7-dihydroxy-3-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)dec-5-enoate.
| Compound Name | methyl (E,3S,4S,7S,9R)-4,7-dihydroxy-3-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)dec-5-enoate |
|---|---|
| PubChem CID | 46854671 |
| Molecular Formula | C24H40O7Si |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | methyl (E,3S,4S,7S,9R)-4,7-dihydroxy-3-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)dec-5-enoate |
| SMILES | COC(=O)C[C@H](OCc1ccccc1)[C@@H](O)/C=C/[C@@H](O)C[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H40O7Si/c1-19(31-18-29-13-14-32(3,4)5)15-21(25)11-12-22(26)23(16-24(27)28-2)30-17-20-9-7-6-8-10-20/h6-12,19,21-23,25-26H,13-18H2,1-5H3/b12-11+/t19-,21-,22+,23+/m1/s1 |
| InChIKey | DIBNSYKLXNEGTI-ZPCXFZQESA-N |
| XLogP | 3.52 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|