About CID 46854718
CID 46854718 (PubChem CID 46854718) has the molecular formula C23H23N3O4
and a molecular weight of 405.45 g/mol.
Molecular Properties
| Compound Name | CID 46854718 |
| PubChem CID | 46854718 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@H]2CN(C)[C@@]3(C(=O)Nc4ccccc43)[C@@]23CC(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-25-13-17(14-8-10-15(30-3)11-9-14)22(12-19(27)26(2)21(22)29)23(25)16-6-4-5-7-18(16)24-20(23)28/h4-11,17H,12-13H2,1-3H3,(H,24,28)/t17-,22+,23+/m1/s1 |
| InChIKey | KJPJYUPBSZQLAB-VSDWSMLSSA-N |
| XLogP | 1.95 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 46854718 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46854718?
The IUPAC name of CID 46854718 (CID 46854718) is not available.
What is the SMILES notation for CID 46854718?
The canonical SMILES for CID 46854718 is COc1ccc([C@H]2CN(C)[C@@]3(C(=O)Nc4ccccc43)[C@@]23CC(=O)N(C)C3=O)cc1.
What is the InChIKey of CID 46854718?
The InChIKey is KJPJYUPBSZQLAB-VSDWSMLSSA-N. The full InChI is InChI=1S/C23H23N3O4/c1-25-13-17(14-8-10-15(30-3)11-9-14)22(12-19(27)26(2)21(22)29)23(25)16-6-4-5-7-18(16)24-20(23)28/h4-11,17H,12-13H2,1-3H3,(H,24,28)/t17-,22+,23+/m1/s1.
What are the key properties of CID 46854718?
CID 46854718 has a molecular weight of 405.45 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46854718 is sourced from PubChem (CID 46854718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).