C33H26N4O2 — CID 46854745
N-[4-[2-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]ethyl]phenyl]benzamide (PubChem CID 46854745) has the molecular formula C33H26N4O2 and a molecular weight of 510.60 g/mol. Its IUPAC name is N-[4-[2-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]ethyl]phenyl]benzamide.
| Compound Name | N-[4-[2-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46854745 |
| Molecular Formula | C33H26N4O2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N-[4-[2-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]ethyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CCNc2ncnc3oc(-c4ccccc4)c(-c4ccccc4)c23)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H26N4O2/c38-32(26-14-8-3-9-15-26)37-27-18-16-23(17-19-27)20-21-34-31-29-28(24-10-4-1-5-11-24)30(25-12-6-2-7-13-25)39-33(29)36-22-35-31/h1-19,22H,20-21H2,(H,37,38)(H,34,35,36) |
| InChIKey | PUASGQFTULISAK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |