C32H50O7Si — CID 46854812
tert-butyl [(1S,2R,5S,6S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,14-trien-13-yl] carbonate (PubChem CID 46854812) has the molecular formula C32H50O7Si and a molecular weight of 574.83 g/mol. Its IUPAC name is tert-butyl [(1S,2R,5S,6S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,14-trien-13-yl] carbonate.
| Compound Name | tert-butyl [(1S,2R,5S,6S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,14-trien-13-yl] carbonate |
|---|---|
| PubChem CID | 46854812 |
| Molecular Formula | C32H50O7Si |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | tert-butyl [(1S,2R,5S,6S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,14-trien-13-yl] carbonate |
| SMILES | COC1(OC)C2=CC3=CC[C@]4(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]4[C@@]34CC[C@]2(C=CC1OC(=O)OC(C)(C)C)O4 |
| InChI | InChI=1S/C32H50O7Si/c1-27(2,3)37-26(33)36-25-15-17-30-18-19-31(39-30)21(20-23(30)32(25,34-8)35-9)14-16-29(7)22(31)12-13-24(29)38-40(10,11)28(4,5)6/h14-15,17,20,22,24-25H,12-13,16,18-19H2,1-11H3/t22-,24+,25?,29+,30+,31-/m1/s1 |
| InChIKey | UAODLHYROWMVML-YBJGVIMWSA-N |
| XLogP | 7.23 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|