C17H18N2O3Se — CID 46854847
2-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)ethyl selenocyanate (PubChem CID 46854847) has the molecular formula C17H18N2O3Se and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)ethyl selenocyanate.
| Compound Name | 2-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)ethyl selenocyanate |
|---|---|
| PubChem CID | 46854847 |
| Molecular Formula | C17H18N2O3Se |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)ethyl selenocyanate |
| SMILES | COc1ccc2c(c1)CCCC21CC(=O)N(CC[Se]C#N)C1=O |
| InChI | InChI=1S/C17H18N2O3Se/c1-22-13-4-5-14-12(9-13)3-2-6-17(14)10-15(20)19(16(17)21)7-8-23-11-18/h4-5,9H,2-3,6-8,10H2,1H3 |
| InChIKey | KYSVJYQKVVLQDM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|