C18H20N2O3Se — CID 46854848
3-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)propyl selenocyanate (PubChem CID 46854848) has the molecular formula C18H20N2O3Se and a molecular weight of 391.33 g/mol. Its IUPAC name is 3-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)propyl selenocyanate.
| Compound Name | 3-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)propyl selenocyanate |
|---|---|
| PubChem CID | 46854848 |
| Molecular Formula | C18H20N2O3Se |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)propyl selenocyanate |
| SMILES | COc1ccc2c(c1)CCCC21CC(=O)N(CCC[Se]C#N)C1=O |
| InChI | InChI=1S/C18H20N2O3Se/c1-23-14-5-6-15-13(10-14)4-2-7-18(15)11-16(21)20(17(18)22)8-3-9-24-12-19/h5-6,10H,2-4,7-9,11H2,1H3 |
| InChIKey | IGTVAFJUURTEDA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|