C19H22N2O3Se — CID 46854849
4-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl selenocyanate (PubChem CID 46854849) has the molecular formula C19H22N2O3Se and a molecular weight of 405.36 g/mol. Its IUPAC name is 4-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl selenocyanate.
| Compound Name | 4-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl selenocyanate |
|---|---|
| PubChem CID | 46854849 |
| Molecular Formula | C19H22N2O3Se |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl selenocyanate |
| SMILES | COc1ccc2c(c1)CCCC21CC(=O)N(CCCC[Se]C#N)C1=O |
| InChI | InChI=1S/C19H22N2O3Se/c1-24-15-6-7-16-14(11-15)5-4-8-19(16)12-17(22)21(18(19)23)9-2-3-10-25-13-20/h6-7,11H,2-5,8-10,12H2,1H3 |
| InChIKey | LUBIMIBXRFTWSC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|