C20H24N2O3Se — CID 46854850
5-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)pentyl selenocyanate (PubChem CID 46854850) has the molecular formula C20H24N2O3Se and a molecular weight of 419.38 g/mol. Its IUPAC name is 5-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)pentyl selenocyanate.
| Compound Name | 5-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)pentyl selenocyanate |
|---|---|
| PubChem CID | 46854850 |
| Molecular Formula | C20H24N2O3Se |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 5-(7-methoxy-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)pentyl selenocyanate |
| SMILES | COc1ccc2c(c1)CCCC21CC(=O)N(CCCCC[Se]C#N)C1=O |
| InChI | InChI=1S/C20H24N2O3Se/c1-25-16-7-8-17-15(12-16)6-5-9-20(17)13-18(23)22(19(20)24)10-3-2-4-11-26-14-21/h7-8,12H,2-6,9-11,13H2,1H3 |
| InChIKey | WTSKQEKRJMFMAP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|