C18H31NO4 — CID 46854958
tert-butyl (2S)-2-[(5S,7E)-4,5-dihydroxynona-1,7-dien-5-yl]pyrrolidine-1-carboxylate (PubChem CID 46854958) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5S,7E)-4,5-dihydroxynona-1,7-dien-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(5S,7E)-4,5-dihydroxynona-1,7-dien-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46854958 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl (2S)-2-[(5S,7E)-4,5-dihydroxynona-1,7-dien-5-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CCC(O)[C@](O)(C/C=C/C)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-6-8-12-18(22,15(20)10-7-2)14-11-9-13-19(14)16(21)23-17(3,4)5/h6-8,14-15,20,22H,2,9-13H2,1,3-5H3/b8-6+/t14-,15?,18-/m0/s1 |
| InChIKey | PEJZXCSRXPDBDV-ZPQNAVRHSA-N |
| XLogP | 3.02 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|