About 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine
2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine (PubChem CID 46854988) has the molecular formula C6H5Cl2F2N3
and a molecular weight of 228.03 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine |
| PubChem CID | 46854988 |
| Molecular Formula | C6H5Cl2F2N3 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine |
| SMILES | FC(F)CNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C6H5Cl2F2N3/c7-3-1-12-6(8)13-5(3)11-2-4(9)10/h1,4H,2H2,(H,11,12,13) |
| InChIKey | QZNCMWBMHBYGGP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine?
The IUPAC name of 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine (CID 46854988) is 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine.
What is the SMILES notation for 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine?
The canonical SMILES for 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine is FC(F)CNc1nc(Cl)ncc1Cl.
What is the InChIKey of 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine?
The InChIKey is QZNCMWBMHBYGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2F2N3/c7-3-1-12-6(8)13-5(3)11-2-4(9)10/h1,4H,2H2,(H,11,12,13).
What are the key properties of 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine?
2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine has a molecular weight of 228.03 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-N-(2,2-difluoroethyl)pyrimidin-4-amine is sourced from PubChem (CID 46854988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).