C21H15BrCl2N4 — CID 46855000
1-(3-bromophenyl)-2-(4,6-dichloropyrimidin-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46855000) has the molecular formula C21H15BrCl2N4 and a molecular weight of 474.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4,6-dichloropyrimidin-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(3-bromophenyl)-2-(4,6-dichloropyrimidin-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46855000 |
| Molecular Formula | C21H15BrCl2N4 |
| Molecular Weight | 474.19 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4,6-dichloropyrimidin-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1cc(Cl)nc(N2CCc3c([nH]c4ccccc34)C2c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C21H15BrCl2N4/c22-13-5-3-4-12(10-13)20-19-15(14-6-1-2-7-16(14)25-19)8-9-28(20)21-26-17(23)11-18(24)27-21/h1-7,10-11,20,25H,8-9H2 |
| InChIKey | GZOMVHPWWAUPIE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.19 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|