About 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine
1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine (PubChem CID 46855245) has the molecular formula C24H25N
and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine.
Molecular Properties
| Compound Name | 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine |
| PubChem CID | 46855245 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine |
| SMILES | Cc1ccc(C#CC(C#Cc2ccc(C)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H25N/c1-20-6-10-22(11-7-20)14-16-24(25-18-4-3-5-19-25)17-15-23-12-8-21(2)9-13-23/h6-13,24H,3-5,18-19H2,1-2H3 |
| InChIKey | XRFAWLKMIGPBFK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine?
The IUPAC name of 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine (CID 46855245) is 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine.
What is the SMILES notation for 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine?
The canonical SMILES for 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine is Cc1ccc(C#CC(C#Cc2ccc(C)cc2)N2CCCCC2)cc1.
What is the InChIKey of 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine?
The InChIKey is XRFAWLKMIGPBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N/c1-20-6-10-22(11-7-20)14-16-24(25-18-4-3-5-19-25)17-15-23-12-8-21(2)9-13-23/h6-13,24H,3-5,18-19H2,1-2H3.
What are the key properties of 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine?
1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine has a molecular weight of 327.47 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,5-bis(4-methylphenyl)penta-1,4-diyn-3-yl]piperidine is sourced from PubChem (CID 46855245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).