C32H38N8O2 — CID 46855310
1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46855310) has the molecular formula C32H38N8O2 and a molecular weight of 566.71 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46855310 |
| Molecular Formula | C32H38N8O2 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CN1CCN(c2cc(N3CCN(C)CC3)nc(N3CCc4c([nH]c5ccccc45)C3c3ccc4c(c3)OCO4)n2)CC1 |
| InChI | InChI=1S/C32H38N8O2/c1-36-11-15-38(16-12-36)28-20-29(39-17-13-37(2)14-18-39)35-32(34-28)40-10-9-24-23-5-3-4-6-25(23)33-30(24)31(40)22-7-8-26-27(19-22)42-21-41-26/h3-8,19-20,31,33H,9-18,21H2,1-2H3 |
| InChIKey | JNRXLWVALXBKDQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|