C34H42N8O2 — CID 46855311
1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-ethylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46855311) has the molecular formula C34H42N8O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-ethylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-ethylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46855311 |
| Molecular Formula | C34H42N8O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[4,6-bis(4-ethylpiperazin-1-yl)pyrimidin-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCN1CCN(c2cc(N3CCN(CC)CC3)nc(N3CCc4c([nH]c5ccccc45)C3c3ccc4c(c3)OCO4)n2)CC1 |
| InChI | InChI=1S/C34H42N8O2/c1-3-38-13-17-40(18-14-38)30-22-31(41-19-15-39(4-2)16-20-41)37-34(36-30)42-12-11-26-25-7-5-6-8-27(25)35-32(26)33(42)24-9-10-28-29(21-24)44-23-43-28/h5-10,21-22,33,35H,3-4,11-20,23H2,1-2H3 |
| InChIKey | ZTPCBWCUAUBETJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|