About 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole
4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole (PubChem CID 46855330) has the molecular formula C13H6Cl2FNS2
and a molecular weight of 330.24 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole |
| PubChem CID | 46855330 |
| Molecular Formula | C13H6Cl2FNS2 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole |
| SMILES | Fc1ccccc1-c1nc(-c2cc(Cl)sc2Cl)cs1 |
| InChI | InChI=1S/C13H6Cl2FNS2/c14-11-5-8(12(15)19-11)10-6-18-13(17-10)7-3-1-2-4-9(7)16/h1-6H |
| InChIKey | XVGPSWKSWHIHGW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole?
The IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole (CID 46855330) is 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole.
What is the SMILES notation for 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole?
The canonical SMILES for 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole is Fc1ccccc1-c1nc(-c2cc(Cl)sc2Cl)cs1.
What is the InChIKey of 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole?
The InChIKey is XVGPSWKSWHIHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl2FNS2/c14-11-5-8(12(15)19-11)10-6-18-13(17-10)7-3-1-2-4-9(7)16/h1-6H.
What are the key properties of 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole?
4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole has a molecular weight of 330.24 g/mol, XLogP of 5.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorothiophen-3-yl)-2-(2-fluorophenyl)-1,3-thiazole is sourced from PubChem (CID 46855330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).