About 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid
2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid (PubChem CID 46855367) has the molecular formula C16H20N2O5
and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid |
| PubChem CID | 46855367 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid |
| SMILES | C[C@@H](OCc1ccccc1)[C@H]1C(=O)N(CC(=O)O)CC(=O)N1C |
| InChI | InChI=1S/C16H20N2O5/c1-11(23-10-12-6-4-3-5-7-12)15-16(22)18(9-14(20)21)8-13(19)17(15)2/h3-7,11,15H,8-10H2,1-2H3,(H,20,21)/t11-,15+/m1/s1 |
| InChIKey | BDGHSIUWPTZGNK-ABAIWWIYSA-N |
| XLogP | 0.35 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid?
The IUPAC name of 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid (CID 46855367) is 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid is C[C@@H](OCc1ccccc1)[C@H]1C(=O)N(CC(=O)O)CC(=O)N1C.
What is the InChIKey of 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid?
The InChIKey is BDGHSIUWPTZGNK-ABAIWWIYSA-N. The full InChI is InChI=1S/C16H20N2O5/c1-11(23-10-12-6-4-3-5-7-12)15-16(22)18(9-14(20)21)8-13(19)17(15)2/h3-7,11,15H,8-10H2,1-2H3,(H,20,21)/t11-,15+/m1/s1.
What are the key properties of 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid?
2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid has a molecular weight of 320.34 g/mol, XLogP of 0.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-4-methyl-2,5-dioxo-3-[(1R)-1-phenylmethoxyethyl]piperazin-1-yl]acetic acid is sourced from PubChem (CID 46855367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).