C52H40N2O6 — CID 46855393
(1S,11E,22S,29R,30R)-29,30-di(anthracen-9-yl)-2,9,14,21-tetraoxa-24,27-diazapentacyclo[25.1.1.122,24.03,8.015,20]triaconta-3,5,7,11,15,17,19-heptaene-23,28-dione (PubChem CID 46855393) has the molecular formula C52H40N2O6 and a molecular weight of 788.90 g/mol. Its IUPAC name is (1S,11E,22S,29R,30R)-29,30-di(anthracen-9-yl)-2,9,14,21-tetraoxa-24,27-diazapentacyclo[25.1.1.122,24.03,8.015,20]triaconta-3,5,7,11,15,17,19-heptaene-23,28-dione.
| Compound Name | (1S,11E,22S,29R,30R)-29,30-di(anthracen-9-yl)-2,9,14,21-tetraoxa-24,27-diazapentacyclo[25.1.1.122,24.03,8.015,20]triaconta-3,5,7,11,15,17,19-heptaene-23,28-dione |
|---|---|
| PubChem CID | 46855393 |
| Molecular Formula | C52H40N2O6 |
| Molecular Weight | 788.90 g/mol |
| Exact Mass | 788.29 |
| IUPAC Name | (1S,11E,22S,29R,30R)-29,30-di(anthracen-9-yl)-2,9,14,21-tetraoxa-24,27-diazapentacyclo[25.1.1.122,24.03,8.015,20]triaconta-3,5,7,11,15,17,19-heptaene-23,28-dione |
| SMILES | O=C1[C@H]2Oc3ccccc3OC/C=C\COc3ccccc3O[C@@H]3C(=O)N(CCN1[C@@H]2c1c2ccccc2cc2ccccc12)[C@@H]3c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C52H40N2O6/c55-51-49-47(45-37-19-5-1-15-33(37)31-34-16-2-6-20-38(34)45)53(51)27-28-54-48(46-39-21-7-3-17-35(39)32-36-18-4-8-22-40(36)46)50(52(54)56)60-44-26-12-10-24-42(44)58-30-14-13-29-57-41-23-9-11-25-43(41)59-49/h1-26,31-32,47-50H,27-30H2/b14-13-/t47-,48-,49+,50+/m1/s1 |
| InChIKey | ABCWLSDEQKRHPF-FQDLMGTISA-N |
| XLogP | 9.99 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.90 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|