About (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine
(5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine (PubChem CID 46855410) has the molecular formula C21H19BrN2O2
and a molecular weight of 411.30 g/mol. Its IUPAC name is (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine.
Molecular Properties
| Compound Name | (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine |
| PubChem CID | 46855410 |
| Molecular Formula | C21H19BrN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine |
| SMILES | C=CC[C@@]1(c2ccc(Br)cc2OC)Oc2ccccc2C2=NCCN=C21 |
| InChI | InChI=1S/C21H19BrN2O2/c1-3-10-21(16-9-8-14(22)13-18(16)25-2)20-19(23-11-12-24-20)15-6-4-5-7-17(15)26-21/h3-9,13H,1,10-12H2,2H3/t21-/m0/s1 |
| InChIKey | QZHQWKFGQYNVLG-NRFANRHFSA-N |
| XLogP | 4.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine?
The IUPAC name of (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine (CID 46855410) is (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine.
What is the SMILES notation for (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine?
The canonical SMILES for (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine is C=CC[C@@]1(c2ccc(Br)cc2OC)Oc2ccccc2C2=NCCN=C21.
What is the InChIKey of (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine?
The InChIKey is QZHQWKFGQYNVLG-NRFANRHFSA-N. The full InChI is InChI=1S/C21H19BrN2O2/c1-3-10-21(16-9-8-14(22)13-18(16)25-2)20-19(23-11-12-24-20)15-6-4-5-7-17(15)26-21/h3-9,13H,1,10-12H2,2H3/t21-/m0/s1.
What are the key properties of (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine?
(5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine has a molecular weight of 411.30 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(4-bromo-2-methoxyphenyl)-5-prop-2-enyl-2,3-dihydrochromeno[3,4-b]pyrazine is sourced from PubChem (CID 46855410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).