C24H21NO5 — CID 46855474
1,8-dimethoxy-10-[(4-methoxyphenyl)methoxyimino]anthracen-9-one (PubChem CID 46855474) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 1,8-dimethoxy-10-[(4-methoxyphenyl)methoxyimino]anthracen-9-one.
| Compound Name | 1,8-dimethoxy-10-[(4-methoxyphenyl)methoxyimino]anthracen-9-one |
|---|---|
| PubChem CID | 46855474 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1,8-dimethoxy-10-[(4-methoxyphenyl)methoxyimino]anthracen-9-one |
| SMILES | COc1ccc(CON=C2c3cccc(OC)c3C(=O)c3c(OC)cccc32)cc1 |
| InChI | InChI=1S/C24H21NO5/c1-27-16-12-10-15(11-13-16)14-30-25-23-17-6-4-8-19(28-2)21(17)24(26)22-18(23)7-5-9-20(22)29-3/h4-13H,14H2,1-3H3 |
| InChIKey | VWHGKAQRYCPUSJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|