About N-benzyl-2,2-dimethoxyethanimine
N-benzyl-2,2-dimethoxyethanimine (PubChem CID 46855578) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-benzyl-2,2-dimethoxyethanimine.
Molecular Properties
| Compound Name | N-benzyl-2,2-dimethoxyethanimine |
| PubChem CID | 46855578 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-benzyl-2,2-dimethoxyethanimine |
| SMILES | COC(/C=N/Cc1ccccc1)OC |
| InChI | InChI=1S/C11H15NO2/c1-13-11(14-2)9-12-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/b12-9+ |
| InChIKey | YFPYRKRKLJKZPA-FMIVXFBMSA-N |
| XLogP | 1.88 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,2-dimethoxyethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2-dimethoxyethanimine?
The IUPAC name of N-benzyl-2,2-dimethoxyethanimine (CID 46855578) is N-benzyl-2,2-dimethoxyethanimine.
What is the SMILES notation for N-benzyl-2,2-dimethoxyethanimine?
The canonical SMILES for N-benzyl-2,2-dimethoxyethanimine is COC(/C=N/Cc1ccccc1)OC.
What is the InChIKey of N-benzyl-2,2-dimethoxyethanimine?
The InChIKey is YFPYRKRKLJKZPA-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H15NO2/c1-13-11(14-2)9-12-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/b12-9+.
What are the key properties of N-benzyl-2,2-dimethoxyethanimine?
N-benzyl-2,2-dimethoxyethanimine has a molecular weight of 193.25 g/mol, XLogP of 1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2-dimethoxyethanimine is sourced from PubChem (CID 46855578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).