About CID 46855617
CID 46855617 (PubChem CID 46855617) has the molecular formula C20H20N3S
and a molecular weight of 334.47 g/mol.
Molecular Properties
| Compound Name | CID 46855617 |
| PubChem CID | 46855617 |
| Molecular Formula | C20H20N3S |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | — |
| SMILES | CSc1ccc(-c2cc([C]3[CH][CH][CH][CH]3)nc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C20H20N3S/c1-24-17-10-8-16(9-11-17)19-14-18(15-6-2-3-7-15)21-20(22-19)23-12-4-5-13-23/h2-3,6-11,14H,4-5,12-13H2,1H3 |
| InChIKey | VNVCBSFWGWJDIB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 46855617 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46855617?
The IUPAC name of CID 46855617 (CID 46855617) is not available.
What is the SMILES notation for CID 46855617?
The canonical SMILES for CID 46855617 is CSc1ccc(-c2cc([C]3[CH][CH][CH][CH]3)nc(N3CCCC3)n2)cc1.
What is the InChIKey of CID 46855617?
The InChIKey is VNVCBSFWGWJDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N3S/c1-24-17-10-8-16(9-11-17)19-14-18(15-6-2-3-7-15)21-20(22-19)23-12-4-5-13-23/h2-3,6-11,14H,4-5,12-13H2,1H3.
What are the key properties of CID 46855617?
CID 46855617 has a molecular weight of 334.47 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46855617 is sourced from PubChem (CID 46855617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).