About 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone
1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone (PubChem CID 46855642) has the molecular formula C14H15Cl2NO
and a molecular weight of 284.19 g/mol. Its IUPAC name is 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone |
| PubChem CID | 46855642 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone |
| SMILES | CC(=O)[C@@]12CNCC[C@]1(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C14H15Cl2NO/c1-9(18)14-7-13(14,4-5-17-8-14)10-2-3-11(15)12(16)6-10/h2-3,6,17H,4-5,7-8H2,1H3/t13-,14-/m1/s1 |
| InChIKey | RYHCLMRIRKKHKV-ZIAGYGMSSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone?
The IUPAC name of 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone (CID 46855642) is 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone.
What is the SMILES notation for 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone?
The canonical SMILES for 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone is CC(=O)[C@@]12CNCC[C@]1(c1ccc(Cl)c(Cl)c1)C2.
What is the InChIKey of 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone?
The InChIKey is RYHCLMRIRKKHKV-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H15Cl2NO/c1-9(18)14-7-13(14,4-5-17-8-14)10-2-3-11(15)12(16)6-10/h2-3,6,17H,4-5,7-8H2,1H3/t13-,14-/m1/s1.
What are the key properties of 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone?
1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone has a molecular weight of 284.19 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]ethanone is sourced from PubChem (CID 46855642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).