C21H32O2 — CID 46855714
(4R,5R)-4-heptyl-2,2-dimethyl-5-[(6R)-6-methyloct-7-en-2,4-diynyl]-1,3-dioxolane (PubChem CID 46855714) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-2,2-dimethyl-5-[(6R)-6-methyloct-7-en-2,4-diynyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-[(6R)-6-methyloct-7-en-2,4-diynyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 46855714 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-[(6R)-6-methyloct-7-en-2,4-diynyl]-1,3-dioxolane |
| SMILES | C=C[C@@H](C)C#CC#CC[C@H]1OC(C)(C)O[C@@H]1CCCCCCC |
| InChI | InChI=1S/C21H32O2/c1-6-8-9-10-13-16-19-20(23-21(4,5)22-19)17-14-11-12-15-18(3)7-2/h7,18-20H,2,6,8-10,13,16-17H2,1,3-5H3/t18-,19-,20-/m1/s1 |
| InChIKey | DGEOFRPVIFARGY-VAMGGRTRSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|