C23H40O4Si — CID 46855803
6-[(3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyundeca-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 46855803) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is 6-[(3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyundeca-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyundeca-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 46855803 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 6-[(3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyundeca-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CCCCC/C=C/C=C/C(CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O4Si/c1-9-10-11-12-13-14-15-16-19(27-28(7,8)22(2,3)4)17-20-18-21(24)26-23(5,6)25-20/h13-16,18-19H,9-12,17H2,1-8H3/b14-13+,16-15+ |
| InChIKey | PHYNPCORZVWHHE-ZBMVRHCNSA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|