About 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol
4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol (PubChem CID 46855975) has the molecular formula C26H40O3Si2
and a molecular weight of 456.78 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol |
| PubChem CID | 46855975 |
| Molecular Formula | C26H40O3Si2 |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(/C=C/c2ccc(O)cc2)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H40O3Si2/c1-25(2,3)30(7,8)28-23-17-21(12-11-20-13-15-22(27)16-14-20)18-24(19-23)29-31(9,10)26(4,5)6/h11-19,27H,1-10H3/b12-11+ |
| InChIKey | JZJYQWCRCCWOPD-VAWYXSNFSA-N |
| XLogP | 8.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol?
The IUPAC name of 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol (CID 46855975) is 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol.
What is the SMILES notation for 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol?
The canonical SMILES for 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol is CC(C)(C)[Si](C)(C)Oc1cc(/C=C/c2ccc(O)cc2)cc(O[Si](C)(C)C(C)(C)C)c1.
What is the InChIKey of 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol?
The InChIKey is JZJYQWCRCCWOPD-VAWYXSNFSA-N. The full InChI is InChI=1S/C26H40O3Si2/c1-25(2,3)30(7,8)28-23-17-21(12-11-20-13-15-22(27)16-14-20)18-24(19-23)29-31(9,10)26(4,5)6/h11-19,27H,1-10H3/b12-11+.
What are the key properties of 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol?
4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol has a molecular weight of 456.78 g/mol, XLogP of 8.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethenyl]phenol is sourced from PubChem (CID 46855975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).