C26H25FN6O — CID 46856027
N-(3-fluorophenyl)-2-[4-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]piperazin-1-yl]acetamide (PubChem CID 46856027) has the molecular formula C26H25FN6O and a molecular weight of 456.53 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46856027 |
| Molecular Formula | C26H25FN6O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2nnc(Cc3ccncc3)c3ccccc23)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C26H25FN6O/c27-20-4-3-5-21(17-20)29-25(34)18-32-12-14-33(15-13-32)26-23-7-2-1-6-22(23)24(30-31-26)16-19-8-10-28-11-9-19/h1-11,17H,12-16,18H2,(H,29,34) |
| InChIKey | KXBXWZGGLHZFKD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |