About 4-chloropyridine-3,5-diamine
4-chloropyridine-3,5-diamine (PubChem CID 46856283) has the molecular formula C5H6ClN3
and a molecular weight of 143.58 g/mol. Its IUPAC name is 4-chloropyridine-3,5-diamine.
Molecular Properties
| Compound Name | 4-chloropyridine-3,5-diamine |
| PubChem CID | 46856283 |
| Molecular Formula | C5H6ClN3 |
| Molecular Weight | 143.58 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 4-chloropyridine-3,5-diamine |
| SMILES | Nc1cncc(N)c1Cl |
| InChI | InChI=1S/C5H6ClN3/c6-5-3(7)1-9-2-4(5)8/h1-2H,7-8H2 |
| InChIKey | ZREDVNRHGOPLJB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.58 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloropyridine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyridine-3,5-diamine?
The IUPAC name of 4-chloropyridine-3,5-diamine (CID 46856283) is 4-chloropyridine-3,5-diamine.
What is the SMILES notation for 4-chloropyridine-3,5-diamine?
The canonical SMILES for 4-chloropyridine-3,5-diamine is Nc1cncc(N)c1Cl.
What is the InChIKey of 4-chloropyridine-3,5-diamine?
The InChIKey is ZREDVNRHGOPLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClN3/c6-5-3(7)1-9-2-4(5)8/h1-2H,7-8H2.
What are the key properties of 4-chloropyridine-3,5-diamine?
4-chloropyridine-3,5-diamine has a molecular weight of 143.58 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyridine-3,5-diamine is sourced from PubChem (CID 46856283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).