About 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde
5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde (PubChem CID 46856445) has the molecular formula C8H5BrN2O
and a molecular weight of 225.05 g/mol. Its IUPAC name is 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde |
| PubChem CID | 46856445 |
| Molecular Formula | C8H5BrN2O |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2ccc(Br)nc12 |
| InChI | InChI=1S/C8H5BrN2O/c9-7-2-1-6-8(11-7)5(4-12)3-10-6/h1-4,10H |
| InChIKey | PUIOZFSCPRTSQS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde?
The IUPAC name of 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde (CID 46856445) is 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde.
What is the SMILES notation for 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde?
The canonical SMILES for 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde is O=Cc1c[nH]c2ccc(Br)nc12.
What is the InChIKey of 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde?
The InChIKey is PUIOZFSCPRTSQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O/c9-7-2-1-6-8(11-7)5(4-12)3-10-6/h1-4,10H.
What are the key properties of 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde?
5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde has a molecular weight of 225.05 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde is sourced from PubChem (CID 46856445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).