C59H64 — CID 46856501
1-[1,1-bis(3,5-ditert-butylphenyl)heptadeca-2,4,6,8,10,12,14,16-octaynyl]-3,5-ditert-butylbenzene (PubChem CID 46856501) has the molecular formula C59H64 and a molecular weight of 773.16 g/mol. Its IUPAC name is 1-[1,1-bis(3,5-ditert-butylphenyl)heptadeca-2,4,6,8,10,12,14,16-octaynyl]-3,5-ditert-butylbenzene.
| Compound Name | 1-[1,1-bis(3,5-ditert-butylphenyl)heptadeca-2,4,6,8,10,12,14,16-octaynyl]-3,5-ditert-butylbenzene |
|---|---|
| PubChem CID | 46856501 |
| Molecular Formula | C59H64 |
| Molecular Weight | 773.16 g/mol |
| Exact Mass | 772.50 |
| IUPAC Name | 1-[1,1-bis(3,5-ditert-butylphenyl)heptadeca-2,4,6,8,10,12,14,16-octaynyl]-3,5-ditert-butylbenzene |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C59H64/c1-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-59(50-38-44(53(2,3)4)35-45(39-50)54(5,6)7,51-40-46(55(8,9)10)36-47(41-51)56(11,12)13)52-42-48(57(14,15)16)37-49(43-52)58(17,18)19/h1,35-43H,2-19H3 |
| InChIKey | HRKUJSSMAOKYFD-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.16 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|