C11H16N2O — CID 46856531
(E)-2-deuterio-4,4-dimethyl-1-(1-methylimidazol-2-yl)pent-2-en-1-one (PubChem CID 46856531) has the molecular formula C11H16N2O and a molecular weight of 193.27 g/mol. Its IUPAC name is (E)-2-deuterio-4,4-dimethyl-1-(1-methylimidazol-2-yl)pent-2-en-1-one.
| Compound Name | (E)-2-deuterio-4,4-dimethyl-1-(1-methylimidazol-2-yl)pent-2-en-1-one |
|---|---|
| PubChem CID | 46856531 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (E)-2-deuterio-4,4-dimethyl-1-(1-methylimidazol-2-yl)pent-2-en-1-one |
| SMILES | [2H]/C(=C\C(C)(C)C)C(=O)c1nccn1C |
| InChI | InChI=1S/C11H16N2O/c1-11(2,3)6-5-9(14)10-12-7-8-13(10)4/h5-8H,1-4H3/b6-5+/i5D |
| InChIKey | DYXLIKSWSNHKBM-GVQVBZPMSA-N |
| XLogP | 2.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|